C12H11Br2ClN2O3S — CID 62127238
3,5-dibromo-4-[(1-ethylpyrazol-4-yl)methoxy]benzenesulfonyl chloride (PubChem CID 62127238) has the molecular formula C12H11Br2ClN2O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is 3,5-dibromo-4-[(1-ethylpyrazol-4-yl)methoxy]benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-[(1-ethylpyrazol-4-yl)methoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62127238 |
| Molecular Formula | C12H11Br2ClN2O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 455.85 |
| IUPAC Name | 3,5-dibromo-4-[(1-ethylpyrazol-4-yl)methoxy]benzenesulfonyl chloride |
| SMILES | CCn1cc(COc2c(Br)cc(S(=O)(=O)Cl)cc2Br)cn1 |
| InChI | InChI=1S/C12H11Br2ClN2O3S/c1-2-17-6-8(5-16-17)7-20-12-10(13)3-9(4-11(12)14)21(15,18)19/h3-6H,2,7H2,1H3 |
| InChIKey | KFVXOYGPOFVYDW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |