C11H13Br2ClO4S — CID 65176689
3,5-dibromo-4-(3-ethoxypropoxy)benzenesulfonyl chloride (PubChem CID 65176689) has the molecular formula C11H13Br2ClO4S and a molecular weight of 436.55 g/mol. Its IUPAC name is 3,5-dibromo-4-(3-ethoxypropoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-(3-ethoxypropoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65176689 |
| Molecular Formula | C11H13Br2ClO4S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | 3,5-dibromo-4-(3-ethoxypropoxy)benzenesulfonyl chloride |
| SMILES | CCOCCCOc1c(Br)cc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C11H13Br2ClO4S/c1-2-17-4-3-5-18-11-9(12)6-8(7-10(11)13)19(14,15)16/h6-7H,2-5H2,1H3 |
| InChIKey | VRGBLOYAINEINC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|