C10H10Br2ClNO4S — CID 82910242
3,5-dibromo-4-[3-(methylamino)-3-oxopropoxy]benzenesulfonyl chloride (PubChem CID 82910242) has the molecular formula C10H10Br2ClNO4S and a molecular weight of 435.52 g/mol. Its IUPAC name is 3,5-dibromo-4-[3-(methylamino)-3-oxopropoxy]benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-[3-(methylamino)-3-oxopropoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910242 |
| Molecular Formula | C10H10Br2ClNO4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 432.84 |
| IUPAC Name | 3,5-dibromo-4-[3-(methylamino)-3-oxopropoxy]benzenesulfonyl chloride |
| SMILES | CNC(=O)CCOc1c(Br)cc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C10H10Br2ClNO4S/c1-14-9(15)2-3-18-10-7(11)4-6(5-8(10)12)19(13,16)17/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | AJGMIJHUBVDQBQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |