C12H15Br2ClO4S — CID 115942390
3,5-dibromo-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonyl chloride (PubChem CID 115942390) has the molecular formula C12H15Br2ClO4S and a molecular weight of 450.58 g/mol. Its IUPAC name is 3,5-dibromo-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 115942390 |
| Molecular Formula | C12H15Br2ClO4S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 447.87 |
| IUPAC Name | 3,5-dibromo-4-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonyl chloride |
| SMILES | CC(C)(C)OCCOc1c(Br)cc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C12H15Br2ClO4S/c1-12(2,3)19-5-4-18-11-9(13)6-8(7-10(11)14)20(15,16)17/h6-7H,4-5H2,1-3H3 |
| InChIKey | AQYISCDJKZAYKU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|