C9H8Br2ClNO3S — CID 82915114
3,5-dibromo-4-[(E)-3-chloroprop-2-enoxy]benzenesulfonamide (PubChem CID 82915114) has the molecular formula C9H8Br2ClNO3S and a molecular weight of 405.50 g/mol. Its IUPAC name is 3,5-dibromo-4-[(E)-3-chloroprop-2-enoxy]benzenesulfonamide.
| Compound Name | 3,5-dibromo-4-[(E)-3-chloroprop-2-enoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82915114 |
| Molecular Formula | C9H8Br2ClNO3S |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 402.83 |
| IUPAC Name | 3,5-dibromo-4-[(E)-3-chloroprop-2-enoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(OC/C=C/Cl)c(Br)c1 |
| InChI | InChI=1S/C9H8Br2ClNO3S/c10-7-4-6(17(13,14)15)5-8(11)9(7)16-3-1-2-12/h1-2,4-5H,3H2,(H2,13,14,15)/b2-1+ |
| InChIKey | AADSPGVEMGJPGM-OWOJBTEDSA-N |
| XLogP | 2.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |