C12H12BrFN2O2 — CID 47082970
2-(4-bromo-2-fluorophenoxy)-N-(cyanomethyl)-N-ethylacetamide (PubChem CID 47082970) has the molecular formula C12H12BrFN2O2 and a molecular weight of 315.14 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-(cyanomethyl)-N-ethylacetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-(cyanomethyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 47082970 |
| Molecular Formula | C12H12BrFN2O2 |
| Molecular Weight | 315.14 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-(cyanomethyl)-N-ethylacetamide |
| SMILES | CCN(CC#N)C(=O)COc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H12BrFN2O2/c1-2-16(6-5-15)12(17)8-18-11-4-3-9(13)7-10(11)14/h3-4,7H,2,6,8H2,1H3 |
| InChIKey | HRJNPXIJNMVXPF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|