C11H11Cl2F3O3S — CID 23530902
(4-tert-butyl-2,3-dichlorophenyl) trifluoromethanesulfonate (PubChem CID 23530902) has the molecular formula C11H11Cl2F3O3S and a molecular weight of 351.17 g/mol. Its IUPAC name is (4-tert-butyl-2,3-dichlorophenyl) trifluoromethanesulfonate.
| Compound Name | (4-tert-butyl-2,3-dichlorophenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23530902 |
| Molecular Formula | C11H11Cl2F3O3S |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | (4-tert-butyl-2,3-dichlorophenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2F3O3S/c1-10(2,3)6-4-5-7(9(13)8(6)12)19-20(17,18)11(14,15)16/h4-5H,1-3H3 |
| InChIKey | RIIWYNADALMDHQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|