C23H15Cl4F3O6S — CID 158065185
1,5-dichloro-6-methoxynaphthalen-2-ol;(1,5-dichloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 158065185) has the molecular formula C23H15Cl4F3O6S and a molecular weight of 618.24 g/mol. Its IUPAC name is 1,5-dichloro-6-methoxynaphthalen-2-ol;(1,5-dichloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | 1,5-dichloro-6-methoxynaphthalen-2-ol;(1,5-dichloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158065185 |
| Molecular Formula | C23H15Cl4F3O6S |
| Molecular Weight | 618.24 g/mol |
| Exact Mass | 615.93 |
| IUPAC Name | 1,5-dichloro-6-methoxynaphthalen-2-ol;(1,5-dichloro-6-methoxynaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(Cl)c(O)ccc2c1Cl.COc1ccc2c(Cl)c(OS(=O)(=O)C(F)(F)F)ccc2c1Cl |
| InChI | InChI=1S/C12H7Cl2F3O4S.C11H8Cl2O2/c1-20-8-4-2-7-6(10(8)13)3-5-9(11(7)14)21-22(18,19)12(15,16)17;1-15-9-5-3-6-7(11(9)13)2-4-8(14)10(6)12/h2-5H,1H3;2-5,14H,1H3 |
| InChIKey | FLDFUSQDXBNNFL-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.24 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|