C8H3Cl2F3O4S — CID 11056387
(2,3-dichloro-4-formylphenyl) trifluoromethanesulfonate (PubChem CID 11056387) has the molecular formula C8H3Cl2F3O4S and a molecular weight of 323.08 g/mol. Its IUPAC name is (2,3-dichloro-4-formylphenyl) trifluoromethanesulfonate.
| Compound Name | (2,3-dichloro-4-formylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11056387 |
| Molecular Formula | C8H3Cl2F3O4S |
| Molecular Weight | 323.08 g/mol |
| Exact Mass | 321.91 |
| IUPAC Name | (2,3-dichloro-4-formylphenyl) trifluoromethanesulfonate |
| SMILES | O=Cc1ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl2F3O4S/c9-6-4(3-14)1-2-5(7(6)10)17-18(15,16)8(11,12)13/h1-3H |
| InChIKey | OPKLTIADNGGTQD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.08 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|