C10H9F3O4S — CID 101194455
(5-formyl-2,4-dimethylphenyl) trifluoromethanesulfonate (PubChem CID 101194455) has the molecular formula C10H9F3O4S and a molecular weight of 282.24 g/mol. Its IUPAC name is (5-formyl-2,4-dimethylphenyl) trifluoromethanesulfonate.
| Compound Name | (5-formyl-2,4-dimethylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101194455 |
| Molecular Formula | C10H9F3O4S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | (5-formyl-2,4-dimethylphenyl) trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(OS(=O)(=O)C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C10H9F3O4S/c1-6-3-7(2)9(4-8(6)5-14)17-18(15,16)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | PVYJCDUVFYKGBY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|