C16H11ClF3NO5S — CID 91089284
(9-chloro-2,4-dimethoxyacridin-1-yl) trifluoromethanesulfonate (PubChem CID 91089284) has the molecular formula C16H11ClF3NO5S and a molecular weight of 421.78 g/mol. Its IUPAC name is (9-chloro-2,4-dimethoxyacridin-1-yl) trifluoromethanesulfonate.
| Compound Name | (9-chloro-2,4-dimethoxyacridin-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91089284 |
| Molecular Formula | C16H11ClF3NO5S |
| Molecular Weight | 421.78 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | (9-chloro-2,4-dimethoxyacridin-1-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c2nc3ccccc3c(Cl)c2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H11ClF3NO5S/c1-24-10-7-11(25-2)15(26-27(22,23)16(18,19)20)12-13(17)8-5-3-4-6-9(8)21-14(10)12/h3-7H,1-2H3 |
| InChIKey | BYWJVYCHNGUICZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|