C11H12ClF3O6S — CID 14522025
[3-chloro-2,6-dimethoxy-4-(methoxymethyl)phenyl] trifluoromethanesulfonate (PubChem CID 14522025) has the molecular formula C11H12ClF3O6S and a molecular weight of 364.73 g/mol. Its IUPAC name is [3-chloro-2,6-dimethoxy-4-(methoxymethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-chloro-2,6-dimethoxy-4-(methoxymethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14522025 |
| Molecular Formula | C11H12ClF3O6S |
| Molecular Weight | 364.73 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [3-chloro-2,6-dimethoxy-4-(methoxymethyl)phenyl] trifluoromethanesulfonate |
| SMILES | COCc1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(OC)c1Cl |
| InChI | InChI=1S/C11H12ClF3O6S/c1-18-5-6-4-7(19-2)9(10(20-3)8(6)12)21-22(16,17)11(13,14)15/h4H,5H2,1-3H3 |
| InChIKey | OQPVCVMRCXDEDL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.73 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|