C13H15F3O8S — CID 10992723
3-methoxy-5-[2-(methoxymethoxy)ethyl]-2-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 10992723) has the molecular formula C13H15F3O8S and a molecular weight of 388.32 g/mol. Its IUPAC name is 3-methoxy-5-[2-(methoxymethoxy)ethyl]-2-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | 3-methoxy-5-[2-(methoxymethoxy)ethyl]-2-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 10992723 |
| Molecular Formula | C13H15F3O8S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 3-methoxy-5-[2-(methoxymethoxy)ethyl]-2-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | COCOCCc1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15F3O8S/c1-21-7-23-4-3-8-5-9(12(17)18)11(10(6-8)22-2)24-25(19,20)13(14,15)16/h5-6H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | CVYIHTIADIHALP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|