C20H19F6NO12S2 — CID 11227511
dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate (PubChem CID 11227511) has the molecular formula C20H19F6NO12S2 and a molecular weight of 643.49 g/mol. Its IUPAC name is dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 11227511 |
| Molecular Formula | C20H19F6NO12S2 |
| Molecular Weight | 643.49 g/mol |
| Exact Mass | 643.03 |
| IUPAC Name | dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1c(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c(C(=O)OC)n1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H19F6NO12S2/c1-34-11-6-5-10(9-12(11)35-2)7-8-27-13(17(28)36-3)15(38-40(30,31)19(21,22)23)16(14(27)18(29)37-4)39-41(32,33)20(24,25)26/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | IASJHVJAIWHCPS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 162.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|