C40H45NO14 — CID 11520591
dimethyl 3,4-bis[4,5-dimethoxy-2-(2-methoxy-2-oxoethyl)phenyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrole-2,5-dicarboxylate (PubChem CID 11520591) has the molecular formula C40H45NO14 and a molecular weight of 763.79 g/mol. Its IUPAC name is dimethyl 3,4-bis[4,5-dimethoxy-2-(2-methoxy-2-oxoethyl)phenyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 3,4-bis[4,5-dimethoxy-2-(2-methoxy-2-oxoethyl)phenyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 11520591 |
| Molecular Formula | C40H45NO14 |
| Molecular Weight | 763.79 g/mol |
| Exact Mass | 763.28 |
| IUPAC Name | dimethyl 3,4-bis[4,5-dimethoxy-2-(2-methoxy-2-oxoethyl)phenyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)Cc1cc(OC)c(OC)cc1-c1c(-c2cc(OC)c(OC)cc2CC(=O)OC)c(C(=O)OC)n(CCc2ccc(OC)c(OC)c2)c1C(=O)OC |
| InChI | InChI=1S/C40H45NO14/c1-46-27-12-11-22(15-28(27)47-2)13-14-41-37(39(44)54-9)35(25-20-31(50-5)29(48-3)16-23(25)18-33(42)52-7)36(38(41)40(45)55-10)26-21-32(51-6)30(49-4)17-24(26)19-34(43)53-8/h11-12,15-17,20-21H,13-14,18-19H2,1-10H3 |
| InChIKey | PAADKGVEJLFWQX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 165.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|