C17H18Br2INO4 — CID 164681897
ethyl 3,4-dibromo-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-iodopyrrole-2-carboxylate (PubChem CID 164681897) has the molecular formula C17H18Br2INO4 and a molecular weight of 587.05 g/mol. Its IUPAC name is ethyl 3,4-dibromo-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-iodopyrrole-2-carboxylate.
| Compound Name | ethyl 3,4-dibromo-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-iodopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 164681897 |
| Molecular Formula | C17H18Br2INO4 |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 584.86 |
| IUPAC Name | ethyl 3,4-dibromo-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-iodopyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(Br)c(Br)c(I)n1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H18Br2INO4/c1-4-25-17(22)15-13(18)14(19)16(20)21(15)8-7-10-5-6-11(23-2)12(9-10)24-3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | FLESTDXXHXFVBI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|