C26H30FNO5 — CID 102251129
ethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate (PubChem CID 102251129) has the molecular formula C26H30FNO5 and a molecular weight of 455.53 g/mol. Its IUPAC name is ethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate.
| Compound Name | ethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102251129 |
| Molecular Formula | C26H30FNO5 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Cc2ccc(F)cc2)C(C)(C)N(CCc2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C26H30FNO5/c1-6-33-25(30)23-20(15-17-7-10-19(27)11-8-17)26(2,3)28(24(23)29)14-13-18-9-12-21(31-4)22(16-18)32-5/h7-12,16H,6,13-15H2,1-5H3 |
| InChIKey | DJOPLTGLIATPJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|