C29H32F3NO11S — CID 102182848
dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxy-3-propan-2-yloxyphenyl)-4-(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate (PubChem CID 102182848) has the molecular formula C29H32F3NO11S and a molecular weight of 659.63 g/mol. Its IUPAC name is dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxy-3-propan-2-yloxyphenyl)-4-(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxy-3-propan-2-yloxyphenyl)-4-(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102182848 |
| Molecular Formula | C29H32F3NO11S |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | dimethyl 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-methoxy-3-propan-2-yloxyphenyl)-4-(trifluoromethylsulfonyloxy)pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1c(OS(=O)(=O)C(F)(F)F)c(-c2ccc(OC)c(OC(C)C)c2)c(C(=O)OC)n1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H32F3NO11S/c1-16(2)43-22-15-18(9-11-20(22)39-4)23-24(27(34)41-6)33(13-12-17-8-10-19(38-3)21(14-17)40-5)25(28(35)42-7)26(23)44-45(36,37)29(30,31)32/h8-11,14-16H,12-13H2,1-7H3 |
| InChIKey | URSHTOZYEFIDSS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 137.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|