C18H27NO6 — CID 11624530
methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methoxy-3-propan-2-yloxyphenyl)ethyl]amino]acetate (PubChem CID 11624530) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methoxy-3-propan-2-yloxyphenyl)ethyl]amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methoxy-3-propan-2-yloxyphenyl)ethyl]amino]acetate |
|---|---|
| PubChem CID | 11624530 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-[2-(4-methoxy-3-propan-2-yloxyphenyl)ethyl]amino]acetate |
| SMILES | COC(=O)CN(CCc1ccc(OC)c(OC(C)C)c1)CC(=O)OC |
| InChI | InChI=1S/C18H27NO6/c1-13(2)25-16-10-14(6-7-15(16)22-3)8-9-19(11-17(20)23-4)12-18(21)24-5/h6-7,10,13H,8-9,11-12H2,1-5H3 |
| InChIKey | QSPCOSNWXUIRRH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |