2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid

C13H18O7S — CID 60925113

IUPAC2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid
SMILESCOCCCS(=O)(=O)c1cc(OC)c(OC)c(C(=O)O)c1
InChIInChI=1S/C13H18O7S/c1-18-5-4-6-21(16,17)9-7-10(13(14)15)12(20-3)11(8-9)19-2/h7-8H,4-6H2,1-3H3,(H,14,15)
InChIKeyLHHZIJJAPIRUAU-UHFFFAOYSA-N
MW318.35 g/mol
LogP1.21
Rot. Bonds8

About 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid

2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid (PubChem CID 60925113) has the molecular formula C13H18O7S and a molecular weight of 318.35 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid.

Molecular Properties

Compound Name2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid
PubChem CID60925113
Molecular FormulaC13H18O7S
Molecular Weight318.35 g/mol
Exact Mass318.08
IUPAC Name2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid
SMILESCOCCCS(=O)(=O)c1cc(OC)c(OC)c(C(=O)O)c1
InChIInChI=1S/C13H18O7S/c1-18-5-4-6-21(16,17)9-7-10(13(14)15)12(20-3)11(8-9)19-2/h7-8H,4-6H2,1-3H3,(H,14,15)
InChIKeyLHHZIJJAPIRUAU-UHFFFAOYSA-N
XLogP1.21
TPSA99.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.35
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid?
The IUPAC name of 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid (CID 60925113) is 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid.
What is the SMILES notation for 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid?
The canonical SMILES for 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid is COCCCS(=O)(=O)c1cc(OC)c(OC)c(C(=O)O)c1.
What is the InChIKey of 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid?
The InChIKey is LHHZIJJAPIRUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O7S/c1-18-5-4-6-21(16,17)9-7-10(13(14)15)12(20-3)11(8-9)19-2/h7-8H,4-6H2,1-3H3,(H,14,15).
What are the key properties of 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid?
2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid has a molecular weight of 318.35 g/mol, XLogP of 1.21, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-5-(3-methoxypropylsulfonyl)benzoic acid is sourced from PubChem (CID 60925113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).