C12H15NO7S — CID 43316894
5-(3-amino-3-oxopropyl)sulfonyl-2,3-dimethoxybenzoic acid (PubChem CID 43316894) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is 5-(3-amino-3-oxopropyl)sulfonyl-2,3-dimethoxybenzoic acid.
| Compound Name | 5-(3-amino-3-oxopropyl)sulfonyl-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 43316894 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-(3-amino-3-oxopropyl)sulfonyl-2,3-dimethoxybenzoic acid |
| SMILES | COc1cc(S(=O)(=O)CCC(N)=O)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C12H15NO7S/c1-19-9-6-7(21(17,18)4-3-10(13)14)5-8(12(15)16)11(9)20-2/h5-6H,3-4H2,1-2H3,(H2,13,14)(H,15,16) |
| InChIKey | XOSQLRQPOYTQPE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |