C14H18O6S — CID 114472944
2,3-dimethoxy-5-(3-methylbut-3-enylsulfonyl)benzoic acid (PubChem CID 114472944) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(3-methylbut-3-enylsulfonyl)benzoic acid.
| Compound Name | 2,3-dimethoxy-5-(3-methylbut-3-enylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 114472944 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2,3-dimethoxy-5-(3-methylbut-3-enylsulfonyl)benzoic acid |
| SMILES | C=C(C)CCS(=O)(=O)c1cc(OC)c(OC)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H18O6S/c1-9(2)5-6-21(17,18)10-7-11(14(15)16)13(20-4)12(8-10)19-3/h7-8H,1,5-6H2,2-4H3,(H,15,16) |
| InChIKey | JUZFORXTOXNLMM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|