C11H15ClO5S — CID 19869410
5-(2-chloroethylsulfonyl)-1,2,3-trimethoxybenzene (PubChem CID 19869410) has the molecular formula C11H15ClO5S and a molecular weight of 294.76 g/mol. Its IUPAC name is 5-(2-chloroethylsulfonyl)-1,2,3-trimethoxybenzene.
| Compound Name | 5-(2-chloroethylsulfonyl)-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 19869410 |
| Molecular Formula | C11H15ClO5S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-(2-chloroethylsulfonyl)-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(S(=O)(=O)CCCl)cc(OC)c1OC |
| InChI | InChI=1S/C11H15ClO5S/c1-15-9-6-8(18(13,14)5-4-12)7-10(16-2)11(9)17-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | DGPJRPKVUFBWLH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|