C12H18ClNO4S — CID 107650684
2-chloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylethanesulfonamide (PubChem CID 107650684) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-chloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylethanesulfonamide.
| Compound Name | 2-chloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 107650684 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-chloro-N-[(2,3-dimethoxyphenyl)methyl]-N-methylethanesulfonamide |
| SMILES | COc1cccc(CN(C)S(=O)(=O)CCCl)c1OC |
| InChI | InChI=1S/C12H18ClNO4S/c1-14(19(15,16)8-7-13)9-10-5-4-6-11(17-2)12(10)18-3/h4-6H,7-9H2,1-3H3 |
| InChIKey | RPHYRIGWASLIFA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|