C14H22N2O3 — CID 79024645
(2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbutanamide (PubChem CID 79024645) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 79024645 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylbutanamide |
| SMILES | CC[C@H](N)C(=O)N(C)Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C14H22N2O3/c1-5-11(15)14(17)16(2)9-10-7-6-8-12(18-3)13(10)19-4/h6-8,11H,5,9,15H2,1-4H3/t11-/m0/s1 |
| InChIKey | OZTYPGNSJOLXGU-NSHDSACASA-N |
| XLogP | 1.40 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |