C12H17FN2O — CID 43649648
2-amino-N-[(2-fluorophenyl)methyl]-N-methylbutanamide (PubChem CID 43649648) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-amino-N-[(2-fluorophenyl)methyl]-N-methylbutanamide.
| Compound Name | 2-amino-N-[(2-fluorophenyl)methyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 43649648 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-amino-N-[(2-fluorophenyl)methyl]-N-methylbutanamide |
| SMILES | CCC(N)C(=O)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C12H17FN2O/c1-3-11(14)12(16)15(2)8-9-6-4-5-7-10(9)13/h4-7,11H,3,8,14H2,1-2H3 |
| InChIKey | XGMLBICNMQKJQY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |