C12H17FN2O — CID 115575226
1-[(2-fluorophenyl)methyl]-1-methyl-3-propan-2-ylurea (PubChem CID 115575226) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-1-methyl-3-propan-2-ylurea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-1-methyl-3-propan-2-ylurea |
|---|---|
| PubChem CID | 115575226 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-1-methyl-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C12H17FN2O/c1-9(2)14-12(16)15(3)8-10-6-4-5-7-11(10)13/h4-7,9H,8H2,1-3H3,(H,14,16) |
| InChIKey | PLDXOXJYQKCXDI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |