C16H26N2O3 — CID 60936664
6-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylhexanamide (PubChem CID 60936664) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 6-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylhexanamide.
| Compound Name | 6-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 60936664 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 6-amino-N-[(2,3-dimethoxyphenyl)methyl]-N-methylhexanamide |
| SMILES | COc1cccc(CN(C)C(=O)CCCCCN)c1OC |
| InChI | InChI=1S/C16H26N2O3/c1-18(15(19)10-5-4-6-11-17)12-13-8-7-9-14(20-2)16(13)21-3/h7-9H,4-6,10-12,17H2,1-3H3 |
| InChIKey | SRNGFXOXTNHXOO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|