C14H19Cl2NO3 — CID 19826571
2,2-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-propan-2-ylacetamide (PubChem CID 19826571) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2,2-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-propan-2-ylacetamide.
| Compound Name | 2,2-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 19826571 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2,2-dichloro-N-[(2,3-dimethoxyphenyl)methyl]-N-propan-2-ylacetamide |
| SMILES | COc1cccc(CN(C(=O)C(Cl)Cl)C(C)C)c1OC |
| InChI | InChI=1S/C14H19Cl2NO3/c1-9(2)17(14(18)13(15)16)8-10-6-5-7-11(19-3)12(10)20-4/h5-7,9,13H,8H2,1-4H3 |
| InChIKey | NDFFPOYQUXJSSL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|