C20H27NO3 — CID 42837199
2-[(2,3-dimethoxyphenyl)methyl-propan-2-ylamino]-1-phenylethanol (PubChem CID 42837199) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl-propan-2-ylamino]-1-phenylethanol.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl-propan-2-ylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 42837199 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl-propan-2-ylamino]-1-phenylethanol |
| SMILES | COc1cccc(CN(CC(O)c2ccccc2)C(C)C)c1OC |
| InChI | InChI=1S/C20H27NO3/c1-15(2)21(14-18(22)16-9-6-5-7-10-16)13-17-11-8-12-19(23-3)20(17)24-4/h5-12,15,18,22H,13-14H2,1-4H3 |
| InChIKey | ZECMLDNYOVBQKI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |