C19H21F3N2O3 — CID 9169420
(2R)-2-[(2,3-dimethoxyphenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 9169420) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is (2R)-2-[(2,3-dimethoxyphenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[(2,3-dimethoxyphenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 9169420 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2R)-2-[(2,3-dimethoxyphenyl)methyl-methylamino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1cccc(CN(C)[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)c1OC |
| InChI | InChI=1S/C19H21F3N2O3/c1-11(19(25)23-14-9-8-13(20)16(21)17(14)22)24(2)10-12-6-5-7-15(26-3)18(12)27-4/h5-9,11H,10H2,1-4H3,(H,23,25)/t11-/m1/s1 |
| InChIKey | OEBLKBFIVVHWQQ-LLVKDONJSA-N |
| XLogP | 3.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|