C18H19F3N2OS — CID 2439515
(2S)-2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2439515) has the molecular formula C18H19F3N2OS and a molecular weight of 368.42 g/mol. Its IUPAC name is (2S)-2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2439515 |
| Molecular Formula | C18H19F3N2OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2S)-2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CSc1ccc(CN(C)[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H19F3N2OS/c1-11(23(2)10-12-4-6-13(25-3)7-5-12)18(24)22-15-9-8-14(19)16(20)17(15)21/h4-9,11H,10H2,1-3H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | WFAZXEWVHDOIAC-NSHDSACASA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|