C16H17F3N2O2 — CID 9102269
(2S)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 9102269) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is (2S)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 9102269 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2S)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1ccc(CN(C)[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-9-4-5-11(23-9)8-21(3)10(2)16(22)20-13-7-6-12(17)14(18)15(13)19/h4-7,10H,8H2,1-3H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | YKQDZTBRVQOKGS-JTQLQIEISA-N |
| XLogP | 3.46 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|