C17H18F3N3O3 — CID 26518608
(2S)-2-[furan-2-ylmethyl(methyl)amino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 26518608) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is (2S)-2-[furan-2-ylmethyl(methyl)amino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2S)-2-[furan-2-ylmethyl(methyl)amino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 26518608 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2S)-2-[furan-2-ylmethyl(methyl)amino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | C[C@@H](C(=O)NCC(=O)Nc1ccc(F)c(F)c1F)N(C)Cc1ccco1 |
| InChI | InChI=1S/C17H18F3N3O3/c1-10(23(2)9-11-4-3-7-26-11)17(25)21-8-14(24)22-13-6-5-12(18)15(19)16(13)20/h3-7,10H,8-9H2,1-2H3,(H,21,25)(H,22,24)/t10-/m0/s1 |
| InChIKey | JITNPYFWNNRYBK-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|