C22H24F3N5O2 — CID 95785613
(2R)-2-[(1-ethylbenzimidazol-2-yl)methyl-methylamino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 95785613) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is (2R)-2-[(1-ethylbenzimidazol-2-yl)methyl-methylamino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2R)-2-[(1-ethylbenzimidazol-2-yl)methyl-methylamino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 95785613 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2R)-2-[(1-ethylbenzimidazol-2-yl)methyl-methylamino]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | CCn1c(CN(C)[C@H](C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)nc2ccccc21 |
| InChI | InChI=1S/C22H24F3N5O2/c1-4-30-17-8-6-5-7-15(17)27-18(30)12-29(3)13(2)22(32)26-11-19(31)28-16-10-9-14(23)20(24)21(16)25/h5-10,13H,4,11-12H2,1-3H3,(H,26,32)(H,28,31)/t13-/m1/s1 |
| InChIKey | MIXVMDJKORPWJB-CYBMUJFWSA-N |
| XLogP | 3.05 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|