C20H24N4O — CID 97064350
(2S)-N-benzyl-2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]propanamide (PubChem CID 97064350) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]propanamide.
| Compound Name | (2S)-N-benzyl-2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 97064350 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2S)-N-benzyl-2-[methyl-[(1-methylbenzimidazol-2-yl)methyl]amino]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccccc1)N(C)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C20H24N4O/c1-15(20(25)21-13-16-9-5-4-6-10-16)23(2)14-19-22-17-11-7-8-12-18(17)24(19)3/h4-12,15H,13-14H2,1-3H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | LFZHABACLATPNX-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |