C15H20N4O — CID 125138149
(2R)-N-benzyl-2-[methyl-(1-methylpyrazol-3-yl)amino]propanamide (PubChem CID 125138149) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is (2R)-N-benzyl-2-[methyl-(1-methylpyrazol-3-yl)amino]propanamide.
| Compound Name | (2R)-N-benzyl-2-[methyl-(1-methylpyrazol-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 125138149 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2R)-N-benzyl-2-[methyl-(1-methylpyrazol-3-yl)amino]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccccc1)N(C)c1ccn(C)n1 |
| InChI | InChI=1S/C15H20N4O/c1-12(19(3)14-9-10-18(2)17-14)15(20)16-11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3,(H,16,20)/t12-/m1/s1 |
| InChIKey | UOSIITVQGSKCRI-GFCCVEGCSA-N |
| XLogP | 1.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |