C16H23N3O — CID 4754827
N-[3-(1-ethylbenzimidazol-2-yl)propyl]-2-methylpropanamide (PubChem CID 4754827) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[3-(1-ethylbenzimidazol-2-yl)propyl]-2-methylpropanamide.
| Compound Name | N-[3-(1-ethylbenzimidazol-2-yl)propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 4754827 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[3-(1-ethylbenzimidazol-2-yl)propyl]-2-methylpropanamide |
| SMILES | CCn1c(CCCNC(=O)C(C)C)nc2ccccc21 |
| InChI | InChI=1S/C16H23N3O/c1-4-19-14-9-6-5-8-13(14)18-15(19)10-7-11-17-16(20)12(2)3/h5-6,8-9,12H,4,7,10-11H2,1-3H3,(H,17,20) |
| InChIKey | MTRWBAZKSLUCER-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|