C21H23Cl2N3O — CID 16980824
N-[3-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-methylpropanamide (PubChem CID 16980824) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[3-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 16980824 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[3-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCc1nc2ccccc2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O/c1-14(2)21(27)24-12-6-11-20-25-18-9-3-4-10-19(18)26(20)13-15-16(22)7-5-8-17(15)23/h3-5,7-10,14H,6,11-13H2,1-2H3,(H,24,27) |
| InChIKey | QSPWONKBJFAWNS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|