C23H27ClFN3O — CID 16988648
N-[5-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide (PubChem CID 16988648) has the molecular formula C23H27ClFN3O and a molecular weight of 415.94 g/mol. Its IUPAC name is N-[5-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide.
| Compound Name | N-[5-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 16988648 |
| Molecular Formula | C23H27ClFN3O |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[5-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCCCc1nc2ccccc2n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H27ClFN3O/c1-16(2)23(29)26-14-7-3-4-13-22-27-20-11-5-6-12-21(20)28(22)15-17-18(24)9-8-10-19(17)25/h5-6,8-12,16H,3-4,7,13-15H2,1-2H3,(H,26,29) |
| InChIKey | QPRHNVUHTJPUFN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|