C17H16ClFN2O — CID 2947354
3-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]propan-1-ol (PubChem CID 2947354) has the molecular formula C17H16ClFN2O and a molecular weight of 318.78 g/mol. Its IUPAC name is 3-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]propan-1-ol.
| Compound Name | 3-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 2947354 |
| Molecular Formula | C17H16ClFN2O |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 3-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]propan-1-ol |
| SMILES | OCCCc1nc2ccccc2n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H16ClFN2O/c18-13-5-3-6-14(19)12(13)11-21-16-8-2-1-7-15(16)20-17(21)9-4-10-22/h1-3,5-8,22H,4,9-11H2 |
| InChIKey | VLSCBDFRMSQISZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |