C25H31Cl2N3O — CID 16988485
N-[5-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-ethylbutanamide (PubChem CID 16988485) has the molecular formula C25H31Cl2N3O and a molecular weight of 460.45 g/mol. Its IUPAC name is N-[5-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-ethylbutanamide.
| Compound Name | N-[5-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 16988485 |
| Molecular Formula | C25H31Cl2N3O |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[5-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCCCCc1nc2ccccc2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H31Cl2N3O/c1-3-18(4-2)25(31)28-16-9-5-6-15-24-29-22-13-7-8-14-23(22)30(24)17-19-20(26)11-10-12-21(19)27/h7-8,10-14,18H,3-6,9,15-17H2,1-2H3,(H,28,31) |
| InChIKey | YGFVCCFUUVRYQX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|