C24H31N3O — CID 16980992
2-ethyl-N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]butanamide (PubChem CID 16980992) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-ethyl-N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]butanamide.
| Compound Name | 2-ethyl-N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]butanamide |
|---|---|
| PubChem CID | 16980992 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-ethyl-N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]butanamide |
| SMILES | CCC(CC)C(=O)NCCCc1nc2ccccc2n1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C24H31N3O/c1-4-20(5-2)24(28)25-16-8-11-23-26-21-9-6-7-10-22(21)27(23)17-19-14-12-18(3)13-15-19/h6-7,9-10,12-15,20H,4-5,8,11,16-17H2,1-3H3,(H,25,28) |
| InChIKey | CRCDVADDTZUMGD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|