C24H24N4O — CID 16964435
N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide (PubChem CID 16964435) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16964435 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(Cn2c(CCCNC(=O)c3cccnc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N4O/c1-18-10-12-19(13-11-18)17-28-22-8-3-2-7-21(22)27-23(28)9-5-15-26-24(29)20-6-4-14-25-16-20/h2-4,6-8,10-14,16H,5,9,15,17H2,1H3,(H,26,29) |
| InChIKey | XKFUAZDJJDVSLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|