C28H32N4O2 — CID 16964498
N-[3-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide (PubChem CID 16964498) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[3-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16964498 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N-[3-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCCCCn2c(CCCNC(=O)c3cccnc3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C28H32N4O2/c1-21-13-14-26(22(2)19-21)34-18-6-5-17-32-25-11-4-3-10-24(25)31-27(32)12-8-16-30-28(33)23-9-7-15-29-20-23/h3-4,7,9-11,13-15,19-20H,5-6,8,12,16-18H2,1-2H3,(H,30,33) |
| InChIKey | OKPOXJWYGQCCRH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|