C22H26F3N3O2 — CID 8709944
(2R)-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]-N-[(2S)-2-phenylbutyl]propanamide (PubChem CID 8709944) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (2R)-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]-N-[(2S)-2-phenylbutyl]propanamide.
| Compound Name | (2R)-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]-N-[(2S)-2-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 8709944 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (2R)-2-[methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]-N-[(2S)-2-phenylbutyl]propanamide |
| SMILES | CC[C@H](CNC(=O)[C@@H](C)N(C)CC(=O)Nc1ccc(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C22H26F3N3O2/c1-4-15(16-8-6-5-7-9-16)12-26-22(30)14(2)28(3)13-19(29)27-18-11-10-17(23)20(24)21(18)25/h5-11,14-15H,4,12-13H2,1-3H3,(H,26,30)(H,27,29)/t14-,15-/m1/s1 |
| InChIKey | UDCWFFLOWMBORP-HUUCEWRRSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|