C22H28FN3O2 — CID 8594421
(2S)-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-[(2R)-2-phenylbutyl]propanamide (PubChem CID 8594421) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is (2S)-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-[(2R)-2-phenylbutyl]propanamide.
| Compound Name | (2S)-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-[(2R)-2-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 8594421 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (2S)-2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-[(2R)-2-phenylbutyl]propanamide |
| SMILES | CC[C@@H](CNC(=O)[C@H](C)N(C)CC(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H28FN3O2/c1-4-17(18-8-6-5-7-9-18)14-24-22(28)16(2)26(3)15-21(27)25-20-12-10-19(23)11-13-20/h5-13,16-17H,4,14-15H2,1-3H3,(H,24,28)(H,25,27)/t16-,17-/m0/s1 |
| InChIKey | SKPHWEZPASNLSV-IRXDYDNUSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |