C19H18F3N5O2S2 — CID 2457916
(2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 2457916) has the molecular formula C19H18F3N5O2S2 and a molecular weight of 469.51 g/mol. Its IUPAC name is (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 2457916 |
| Molecular Formula | C19H18F3N5O2S2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)nnc1-c1cccs1 |
| InChI | InChI=1S/C19H18F3N5O2S2/c1-3-27-17(13-5-4-8-30-13)25-26-19(27)31-10(2)18(29)23-9-14(28)24-12-7-6-11(20)15(21)16(12)22/h4-8,10H,3,9H2,1-2H3,(H,23,29)(H,24,28)/t10-/m1/s1 |
| InChIKey | DXSWFDGVGDXGNQ-SNVBAGLBSA-N |
| XLogP | 3.68 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|