C17H16FN5O3S2 — CID 41071894
(2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 41071894) has the molecular formula C17H16FN5O3S2 and a molecular weight of 421.48 g/mol. Its IUPAC name is (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 41071894 |
| Molecular Formula | C17H16FN5O3S2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (2R)-2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)nnc1-c1cccs1 |
| InChI | InChI=1S/C17H16FN5O3S2/c1-3-22-15(14-5-4-8-27-14)20-21-17(22)28-10(2)16(24)19-11-6-7-12(18)13(9-11)23(25)26/h4-10H,3H2,1-2H3,(H,19,24)/t10-/m1/s1 |
| InChIKey | ZRHSLDKKMZJUFR-SNVBAGLBSA-N |
| XLogP | 4.19 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|