C22H17F3N4O2S2 — CID 25344492
(2R)-2-[[4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 25344492) has the molecular formula C22H17F3N4O2S2 and a molecular weight of 490.53 g/mol. Its IUPAC name is (2R)-2-[[4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[[4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 25344492 |
| Molecular Formula | C22H17F3N4O2S2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | (2R)-2-[[4-(2-methoxyphenyl)-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | COc1ccccc1-n1c(S[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)nnc1-c1cccs1 |
| InChI | InChI=1S/C22H17F3N4O2S2/c1-12(21(30)26-14-10-9-13(23)18(24)19(14)25)33-22-28-27-20(17-8-5-11-32-17)29(22)15-6-3-4-7-16(15)31-2/h3-12H,1-2H3,(H,26,30)/t12-/m1/s1 |
| InChIKey | WWKZXKMHDWYPBY-GFCCVEGCSA-N |
| XLogP | 5.54 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|